C26H24O2 — CID 160512136
1-[2-(1,4,5,8-tetramethyl-3-methylidenexanthen-9-yl)phenyl]ethanone (PubChem CID 160512136) has the molecular formula C26H24O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[2-(1,4,5,8-tetramethyl-3-methylidenexanthen-9-yl)phenyl]ethanone.
| Compound Name | 1-[2-(1,4,5,8-tetramethyl-3-methylidenexanthen-9-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 160512136 |
| Molecular Formula | C26H24O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[2-(1,4,5,8-tetramethyl-3-methylidenexanthen-9-yl)phenyl]ethanone |
| SMILES | C=c1cc(C)c2c(c1C)Oc1c(C)ccc(C)c1C=2c1ccccc1C(C)=O |
| InChI | InChI=1S/C26H24O2/c1-14-11-12-15(2)25-22(14)24(21-10-8-7-9-20(21)19(6)27)23-17(4)13-16(3)18(5)26(23)28-25/h7-13H,3H2,1-2,4-6H3 |
| InChIKey | ZEANSAQBZPZNLG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |