C22H16O4 — CID 121431911
2-(2-methoxy-6-methylidenexanthen-9-yl)benzoic acid (PubChem CID 121431911) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-(2-methoxy-6-methylidenexanthen-9-yl)benzoic acid.
| Compound Name | 2-(2-methoxy-6-methylidenexanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 121431911 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(2-methoxy-6-methylidenexanthen-9-yl)benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1ccc(OC)cc1C=2c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H16O4/c1-13-7-9-17-20(11-13)26-19-10-8-14(25-2)12-18(19)21(17)15-5-3-4-6-16(15)22(23)24/h3-12H,1H2,2H3,(H,23,24) |
| InChIKey | QVCDEANGUUHFOV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |