C29H35N3O2 — CID 11669733
6-[3,6-bis(diethylamino)xanthen-9-ylidene]-4-(dimethylamino)cyclohexa-2,4-dien-1-one (PubChem CID 11669733) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 6-[3,6-bis(diethylamino)xanthen-9-ylidene]-4-(dimethylamino)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-[3,6-bis(diethylamino)xanthen-9-ylidene]-4-(dimethylamino)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11669733 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 6-[3,6-bis(diethylamino)xanthen-9-ylidene]-4-(dimethylamino)cyclohexa-2,4-dien-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C2=C1C=C(N(C)C)C=CC1=O |
| InChI | InChI=1S/C29H35N3O2/c1-7-31(8-2)21-11-14-23-27(18-21)34-28-19-22(32(9-3)10-4)12-15-24(28)29(23)25-17-20(30(5)6)13-16-26(25)33/h11-19H,7-10H2,1-6H3 |
| InChIKey | YNJWVVGEXNNDAH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|