C52H48I2N6O8 — CID 171380585
6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-(2-iodoacetyl)iminocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 171380585) has the molecular formula C52H48I2N6O8 and a molecular weight of 1138.80 g/mol. Its IUPAC name is 6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-(2-iodoacetyl)iminocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | 6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-(2-iodoacetyl)iminocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 171380585 |
| Molecular Formula | C52H48I2N6O8 |
| Molecular Weight | 1138.80 g/mol |
| Exact Mass | 1138.16 |
| IUPAC Name | 6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-(2-iodoacetyl)iminocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C2=C1C=C/C(=N\C(=O)CI)C=C1C(=O)O.CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C2=C1C=C/C(=N\C(=O)CI)C=C1C(=O)O |
| InChI | InChI=1S/2C26H24IN3O4/c2*1-29(2)16-6-9-19-22(12-16)34-23-13-17(30(3)4)7-10-20(23)25(19)18-8-5-15(28-24(31)14-27)11-21(18)26(32)33/h2*5-13H,14H2,1-4H3,(H,32,33)/b2*28-15+ |
| InChIKey | YVDAJBNKXNRZCZ-AHVIDAKYSA-N |
| XLogP | 9.42 |
| TPSA | 164.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.80 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|