C30H34N4O4 — CID 20591590
3-(6-aminohexanoylimino)-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]cyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 20591590) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 3-(6-aminohexanoylimino)-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]cyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | 3-(6-aminohexanoylimino)-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]cyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 20591590 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-(6-aminohexanoylimino)-6-[3,6-bis(dimethylamino)xanthen-9-ylidene]cyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C2=C1C=C/C(=N\C(=O)CCCCCN)C=C1C(=O)O |
| InChI | InChI=1S/C30H34N4O4/c1-33(2)20-10-13-23-26(17-20)38-27-18-21(34(3)4)11-14-24(27)29(23)22-12-9-19(16-25(22)30(36)37)32-28(35)8-6-5-7-15-31/h9-14,16-18H,5-8,15,31H2,1-4H3,(H,36,37)/b32-19+ |
| InChIKey | WMPSSHDUQIDMCW-BIZUNTBRSA-N |
| XLogP | 4.79 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|