C25H25NO — CID 146319603
N,N-diethyl-6-methylidene-9-(4-methylphenyl)xanthen-3-amine (PubChem CID 146319603) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is N,N-diethyl-6-methylidene-9-(4-methylphenyl)xanthen-3-amine.
| Compound Name | N,N-diethyl-6-methylidene-9-(4-methylphenyl)xanthen-3-amine |
|---|---|
| PubChem CID | 146319603 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N,N-diethyl-6-methylidene-9-(4-methylphenyl)xanthen-3-amine |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C=2c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO/c1-5-26(6-2)20-12-14-22-24(16-20)27-23-15-18(4)9-13-21(23)25(22)19-10-7-17(3)8-11-19/h7-16H,4-6H2,1-3H3 |
| InChIKey | GJUKCTBSEOXERW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|