C35H38N2O8S2 — CID 118263539
2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-[[5-(2-methylprop-2-enoyloxy)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzenesulfonic acid (PubChem CID 118263539) has the molecular formula C35H38N2O8S2 and a molecular weight of 678.83 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-[[5-(2-methylprop-2-enoyloxy)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzenesulfonic acid.
| Compound Name | 2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-[[5-(2-methylprop-2-enoyloxy)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118263539 |
| Molecular Formula | C35H38N2O8S2 |
| Molecular Weight | 678.83 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | 2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-[[5-(2-methylprop-2-enoyloxy)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)OC1CC2CC1CC2NS(=O)(=O)c1ccc(C2=c3ccc(=C)cc3Oc3cc(N(CC)CC)ccc32)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C35H38N2O8S2/c1-6-37(7-2)24-9-12-27-32(18-24)44-31-14-21(5)8-11-26(31)34(27)28-13-10-25(19-33(28)47(41,42)43)46(39,40)36-29-16-23-15-22(29)17-30(23)45-35(38)20(3)4/h8-14,18-19,22-23,29-30,36H,3,5-7,15-17H2,1-2,4H3,(H,41,42,43) |
| InChIKey | LEPFVAVZOGPOTO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|