C23H22N2O — CID 146319584
N,N-diethyl-6-methylidene-9-pyridin-3-ylxanthen-3-amine (PubChem CID 146319584) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is N,N-diethyl-6-methylidene-9-pyridin-3-ylxanthen-3-amine.
| Compound Name | N,N-diethyl-6-methylidene-9-pyridin-3-ylxanthen-3-amine |
|---|---|
| PubChem CID | 146319584 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N,N-diethyl-6-methylidene-9-pyridin-3-ylxanthen-3-amine |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C=2c1cccnc1 |
| InChI | InChI=1S/C23H22N2O/c1-4-25(5-2)18-9-11-20-22(14-18)26-21-13-16(3)8-10-19(21)23(20)17-7-6-12-24-15-17/h6-15H,3-5H2,1-2H3 |
| InChIKey | XBDOCLJQOQUWLP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|