About 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine
9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine (PubChem CID 21053809) has the molecular formula C22H20N2O
and a molecular weight of 328.42 g/mol. Its IUPAC name is 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine.
Molecular Properties
| Compound Name | 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine |
| PubChem CID | 21053809 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(C)C)ccc1C=2c1ccc(N)cc1 |
| InChI | InChI=1S/C22H20N2O/c1-14-4-10-18-20(12-14)25-21-13-17(24(2)3)9-11-19(21)22(18)15-5-7-16(23)8-6-15/h4-13H,1,23H2,2-3H3 |
| InChIKey | ZIANGBVNPBZXJJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine?
The IUPAC name of 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine (CID 21053809) is 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine.
What is the SMILES notation for 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine?
The canonical SMILES for 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine is C=c1ccc2c(c1)Oc1cc(N(C)C)ccc1C=2c1ccc(N)cc1.
What is the InChIKey of 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine?
The InChIKey is ZIANGBVNPBZXJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O/c1-14-4-10-18-20(12-14)25-21-13-17(24(2)3)9-11-19(21)22(18)15-5-7-16(23)8-6-15/h4-13H,1,23H2,2-3H3.
What are the key properties of 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine?
9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine has a molecular weight of 328.42 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-aminophenyl)-N,N-dimethyl-6-methylidenexanthen-3-amine is sourced from PubChem (CID 21053809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).