C32H30O3 — CID 59630545
9-[3-[2-(2,5-dimethylphenoxy)ethoxy]-4-methylphenyl]-3-methyl-6-methylidenexanthene (PubChem CID 59630545) has the molecular formula C32H30O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 9-[3-[2-(2,5-dimethylphenoxy)ethoxy]-4-methylphenyl]-3-methyl-6-methylidenexanthene.
| Compound Name | 9-[3-[2-(2,5-dimethylphenoxy)ethoxy]-4-methylphenyl]-3-methyl-6-methylidenexanthene |
|---|---|
| PubChem CID | 59630545 |
| Molecular Formula | C32H30O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 9-[3-[2-(2,5-dimethylphenoxy)ethoxy]-4-methylphenyl]-3-methyl-6-methylidenexanthene |
| SMILES | C=c1ccc2c(c1)Oc1cc(C)ccc1C=2c1ccc(C)c(OCCOc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C32H30O3/c1-20-6-9-23(4)28(16-20)33-14-15-34-29-19-25(11-10-24(29)5)32-26-12-7-21(2)17-30(26)35-31-18-22(3)8-13-27(31)32/h6-13,16-19H,2,14-15H2,1,3-5H3 |
| InChIKey | KTPGGYUONGRXRG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|