C21H16O7S2 — CID 20750820
4-(3-methyl-6-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid (PubChem CID 20750820) has the molecular formula C21H16O7S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-(3-methyl-6-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(3-methyl-6-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 20750820 |
| Molecular Formula | C21H16O7S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 4-(3-methyl-6-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(C)ccc1C=2c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C21H16O7S2/c1-12-3-6-15-18(9-12)28-19-10-13(2)4-7-16(19)21(15)17-8-5-14(29(22,23)24)11-20(17)30(25,26)27/h3-11H,1H2,2H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | OIFNZMYVECGCFH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|