C32H33NO7S2 — CID 121360595
4-(3-amino-9,11-dibutyl-10-methylidenebenzo[c]xanthen-7-yl)benzene-1,3-disulfonic acid (PubChem CID 121360595) has the molecular formula C32H33NO7S2 and a molecular weight of 607.75 g/mol. Its IUPAC name is 4-(3-amino-9,11-dibutyl-10-methylidenebenzo[c]xanthen-7-yl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(3-amino-9,11-dibutyl-10-methylidenebenzo[c]xanthen-7-yl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 121360595 |
| Molecular Formula | C32H33NO7S2 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.17 |
| IUPAC Name | 4-(3-amino-9,11-dibutyl-10-methylidenebenzo[c]xanthen-7-yl)benzene-1,3-disulfonic acid |
| SMILES | C=c1c(CCCC)cc2c(c1CCCC)Oc1c(ccc3cc(N)ccc13)C=2c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C32H33NO7S2/c1-4-6-8-20-17-28-30(26-15-12-23(41(34,35)36)18-29(26)42(37,38)39)27-13-10-21-16-22(33)11-14-25(21)32(27)40-31(28)24(19(20)3)9-7-5-2/h10-18H,3-9,33H2,1-2H3,(H,34,35,36)(H,37,38,39) |
| InChIKey | DCMSNRJKJDYSHL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|