C28H29BrO7S2 — CID 121360594
4-(6-bromo-2,4-dibutyl-3-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid (PubChem CID 121360594) has the molecular formula C28H29BrO7S2 and a molecular weight of 621.57 g/mol. Its IUPAC name is 4-(6-bromo-2,4-dibutyl-3-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(6-bromo-2,4-dibutyl-3-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 121360594 |
| Molecular Formula | C28H29BrO7S2 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 4-(6-bromo-2,4-dibutyl-3-methylidenexanthen-9-yl)benzene-1,3-disulfonic acid |
| SMILES | C=c1c(CCCC)cc2c(c1CCCC)Oc1cc(Br)ccc1C=2c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C28H29BrO7S2/c1-4-6-8-18-14-24-27(23-13-11-20(37(30,31)32)16-26(23)38(33,34)35)22-12-10-19(29)15-25(22)36-28(24)21(17(18)3)9-7-5-2/h10-16H,3-9H2,1-2H3,(H,30,31,32)(H,33,34,35) |
| InChIKey | YORTVHZKDINQQX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|