C17H31NO3S — CID 174758788
azane;3-butyl-4-(3-ethylpentan-3-yl)benzenesulfonic acid (PubChem CID 174758788) has the molecular formula C17H31NO3S and a molecular weight of 329.51 g/mol. Its IUPAC name is azane;3-butyl-4-(3-ethylpentan-3-yl)benzenesulfonic acid.
| Compound Name | azane;3-butyl-4-(3-ethylpentan-3-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 174758788 |
| Molecular Formula | C17H31NO3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | azane;3-butyl-4-(3-ethylpentan-3-yl)benzenesulfonic acid |
| SMILES | CCCCc1cc(S(=O)(=O)O)ccc1C(CC)(CC)CC.N |
| InChI | InChI=1S/C17H28O3S.H3N/c1-5-9-10-14-13-15(21(18,19)20)11-12-16(14)17(6-2,7-3)8-4;/h11-13H,5-10H2,1-4H3,(H,18,19,20);1H3 |
| InChIKey | HEPIGRZGSBCQID-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|