C20H25NO5S — CID 174406688
azane;4-butyl-9,10-dimethoxyanthracene-2-sulfonic acid (PubChem CID 174406688) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is azane;4-butyl-9,10-dimethoxyanthracene-2-sulfonic acid.
| Compound Name | azane;4-butyl-9,10-dimethoxyanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 174406688 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | azane;4-butyl-9,10-dimethoxyanthracene-2-sulfonic acid |
| SMILES | CCCCc1cc(S(=O)(=O)O)cc2c(OC)c3ccccc3c(OC)c12.N |
| InChI | InChI=1S/C20H22O5S.H3N/c1-4-5-8-13-11-14(26(21,22)23)12-17-18(13)20(25-3)16-10-7-6-9-15(16)19(17)24-2;/h6-7,9-12H,4-5,8H2,1-3H3,(H,21,22,23);1H3 |
| InChIKey | XHJGVEKYIQHAGP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|