C18H22N2O6S2 — CID 175969185
3-amino-6-[2-(4-amino-2-sulfophenyl)ethenyl]-2-butylbenzenesulfonic acid (PubChem CID 175969185) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-amino-6-[2-(4-amino-2-sulfophenyl)ethenyl]-2-butylbenzenesulfonic acid.
| Compound Name | 3-amino-6-[2-(4-amino-2-sulfophenyl)ethenyl]-2-butylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175969185 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-amino-6-[2-(4-amino-2-sulfophenyl)ethenyl]-2-butylbenzenesulfonic acid |
| SMILES | CCCCc1c(N)ccc(C=Cc2ccc(N)cc2S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C18H22N2O6S2/c1-2-3-4-15-16(20)10-8-13(18(15)28(24,25)26)6-5-12-7-9-14(19)11-17(12)27(21,22)23/h5-11H,2-4,19-20H2,1H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | DJYSMXWEJGIYPG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|