C14H14N2O6S2 — CID 59922448
5-amino-2-[2-(4-amino-2-sulfinooxyphenyl)ethenyl]benzenesulfonic acid (PubChem CID 59922448) has the molecular formula C14H14N2O6S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-amino-2-[2-(4-amino-2-sulfinooxyphenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-amino-2-[2-(4-amino-2-sulfinooxyphenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59922448 |
| Molecular Formula | C14H14N2O6S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5-amino-2-[2-(4-amino-2-sulfinooxyphenyl)ethenyl]benzenesulfonic acid |
| SMILES | Nc1ccc(C=Cc2ccc(N)cc2S(=O)(=O)O)c(OS(=O)O)c1 |
| InChI | InChI=1S/C14H14N2O6S2/c15-11-5-3-9(13(7-11)22-23(17)18)1-2-10-4-6-12(16)8-14(10)24(19,20)21/h1-8H,15-16H2,(H,17,18)(H,19,20,21) |
| InChIKey | DURKHQFKKRAWEO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|