C14H11N2O8S2- — CID 3330285
5-amino-2-[2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonate (PubChem CID 3330285) has the molecular formula C14H11N2O8S2- and a molecular weight of 399.38 g/mol. Its IUPAC name is 5-amino-2-[2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonate.
| Compound Name | 5-amino-2-[2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 3330285 |
| Molecular Formula | C14H11N2O8S2- |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 5-amino-2-[2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonate |
| SMILES | Nc1ccc(C=Cc2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H12N2O8S2/c15-11-5-3-9(13(7-11)25(19,20)21)1-2-10-4-6-12(16(17)18)8-14(10)26(22,23)24/h1-8H,15H2,(H,19,20,21)(H,22,23,24)/p-1 |
| InChIKey | GHBWBMDGBCKAQU-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 180.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|