C14H7BrN2O10S2-2 — CID 7158800
2-[(E)-2-bromo-2-(4-nitro-2-sulfonatophenyl)ethenyl]-5-nitrobenzenesulfonate (PubChem CID 7158800) has the molecular formula C14H7BrN2O10S2-2 and a molecular weight of 507.25 g/mol. Its IUPAC name is 2-[(E)-2-bromo-2-(4-nitro-2-sulfonatophenyl)ethenyl]-5-nitrobenzenesulfonate.
| Compound Name | 2-[(E)-2-bromo-2-(4-nitro-2-sulfonatophenyl)ethenyl]-5-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 7158800 |
| Molecular Formula | C14H7BrN2O10S2-2 |
| Molecular Weight | 507.25 g/mol |
| Exact Mass | 505.87 |
| IUPAC Name | 2-[(E)-2-bromo-2-(4-nitro-2-sulfonatophenyl)ethenyl]-5-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(/C=C(/Br)c2ccc([N+](=O)[O-])cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C14H9BrN2O10S2/c15-12(11-4-3-10(17(20)21)7-14(11)29(25,26)27)5-8-1-2-9(16(18)19)6-13(8)28(22,23)24/h1-7H,(H,22,23,24)(H,25,26,27)/p-2/b12-5+ |
| InChIKey | GKZGDBPAYJJFFF-LFYBBSHMSA-L |
| XLogP | 2.20 |
| TPSA | 200.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|