C27H28I2NNaO7S2V — CID 158791063
sodium;4-[(3E)-3-butan-2-ylidene-6-(diethylamino)xanthen-9-yl]-3-sulfobenzenesulfonate;diiodovanadium (PubChem CID 158791063) has the molecular formula C27H28I2NNaO7S2V and a molecular weight of 870.40 g/mol. Its IUPAC name is sodium;4-[(3E)-3-butan-2-ylidene-6-(diethylamino)xanthen-9-yl]-3-sulfobenzenesulfonate;diiodovanadium.
| Compound Name | sodium;4-[(3E)-3-butan-2-ylidene-6-(diethylamino)xanthen-9-yl]-3-sulfobenzenesulfonate;diiodovanadium |
|---|---|
| PubChem CID | 158791063 |
| Molecular Formula | C27H28I2NNaO7S2V |
| Molecular Weight | 870.40 g/mol |
| Exact Mass | 869.87 |
| IUPAC Name | sodium;4-[(3E)-3-butan-2-ylidene-6-(diethylamino)xanthen-9-yl]-3-sulfobenzenesulfonate;diiodovanadium |
| SMILES | CC/C(C)=c1\ccc2c(c1)Oc1cc(N(CC)CC)ccc1C=2c1ccc(S(=O)(=O)[O-])cc1S(=O)(=O)O.I[V]I.[Na+] |
| InChI | InChI=1S/C27H29NO7S2.2HI.Na.V/c1-5-17(4)18-8-11-21-24(14-18)35-25-15-19(28(6-2)7-3)9-12-22(25)27(21)23-13-10-20(36(29,30)31)16-26(23)37(32,33)34;;;;/h8-16H,5-7H2,1-4H3,(H,29,30,31)(H,32,33,34);2*1H;;/q;;;+1;+2/p-3/b18-17+;;;; |
| InChIKey | ISGZPBSYXRCRHM-MJCKVQKWSA-K |
| XLogP | 2.39 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|