C25H28N2O7S2 — CID 121388972
4-[3-(dimethylamino)-6-[ethyl(methyl)amino]-3-methylxanthen-9-yl]benzene-1,3-disulfonic acid (PubChem CID 121388972) has the molecular formula C25H28N2O7S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 4-[3-(dimethylamino)-6-[ethyl(methyl)amino]-3-methylxanthen-9-yl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[3-(dimethylamino)-6-[ethyl(methyl)amino]-3-methylxanthen-9-yl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 121388972 |
| Molecular Formula | C25H28N2O7S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 4-[3-(dimethylamino)-6-[ethyl(methyl)amino]-3-methylxanthen-9-yl]benzene-1,3-disulfonic acid |
| SMILES | CCN(C)c1ccc2c(c1)OC1=CC(C)(N(C)C)C=CC1=C2c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C25H28N2O7S2/c1-6-27(5)16-7-9-18-21(13-16)34-22-15-25(2,26(3)4)12-11-19(22)24(18)20-10-8-17(35(28,29)30)14-23(20)36(31,32)33/h7-15H,6H2,1-5H3,(H,28,29,30)(H,31,32,33) |
| InChIKey | AJDYRIPHSIKYNG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|