C28H30ClNO6S2 — CID 59561742
5-chlorosulfonyl-2-[3-(diethylamino)-6-pentan-3-ylidenexanthen-9-yl]benzenesulfonic acid (PubChem CID 59561742) has the molecular formula C28H30ClNO6S2 and a molecular weight of 576.14 g/mol. Its IUPAC name is 5-chlorosulfonyl-2-[3-(diethylamino)-6-pentan-3-ylidenexanthen-9-yl]benzenesulfonic acid.
| Compound Name | 5-chlorosulfonyl-2-[3-(diethylamino)-6-pentan-3-ylidenexanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59561742 |
| Molecular Formula | C28H30ClNO6S2 |
| Molecular Weight | 576.14 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 5-chlorosulfonyl-2-[3-(diethylamino)-6-pentan-3-ylidenexanthen-9-yl]benzenesulfonic acid |
| SMILES | CCC(CC)=c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C=2c1ccc(S(=O)(=O)Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C28H30ClNO6S2/c1-5-18(6-2)19-9-12-22-25(15-19)36-26-16-20(30(7-3)8-4)10-13-23(26)28(22)24-14-11-21(37(29,31)32)17-27(24)38(33,34)35/h9-17H,5-8H2,1-4H3,(H,33,34,35) |
| InChIKey | YLYPFQDJMKFEAE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|