C28H29N5O3 — CID 122174015
5-[3,6-bis(diethylamino)xanthen-9-ylidene]benzotriazole-4-carboxylic acid (PubChem CID 122174015) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 5-[3,6-bis(diethylamino)xanthen-9-ylidene]benzotriazole-4-carboxylic acid.
| Compound Name | 5-[3,6-bis(diethylamino)xanthen-9-ylidene]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 122174015 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 5-[3,6-bis(diethylamino)xanthen-9-ylidene]benzotriazole-4-carboxylic acid |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C2=c1ccc2c(c1C(=O)O)N=NN=2 |
| InChI | InChI=1S/C28H29N5O3/c1-5-32(6-2)17-9-11-19-23(15-17)36-24-16-18(33(7-3)8-4)10-12-20(24)25(19)21-13-14-22-27(30-31-29-22)26(21)28(34)35/h9-16H,5-8H2,1-4H3,(H,34,35) |
| InChIKey | AGMITIODZMEPGK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|