C37H37N5O4 — CID 136877140
N-[5-[6-[3,6-bis(diethylamino)xanthen-9-ylidene]cyclohexa-2,4-dien-1-ylidene]-1,3,4-oxadiazol-2-ylidene]-4-methoxybenzamide (PubChem CID 136877140) has the molecular formula C37H37N5O4 and a molecular weight of 615.73 g/mol. Its IUPAC name is N-[5-[6-[3,6-bis(diethylamino)xanthen-9-ylidene]cyclohexa-2,4-dien-1-ylidene]-1,3,4-oxadiazol-2-ylidene]-4-methoxybenzamide.
| Compound Name | N-[5-[6-[3,6-bis(diethylamino)xanthen-9-ylidene]cyclohexa-2,4-dien-1-ylidene]-1,3,4-oxadiazol-2-ylidene]-4-methoxybenzamide |
|---|---|
| PubChem CID | 136877140 |
| Molecular Formula | C37H37N5O4 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | N-[5-[6-[3,6-bis(diethylamino)xanthen-9-ylidene]cyclohexa-2,4-dien-1-ylidene]-1,3,4-oxadiazol-2-ylidene]-4-methoxybenzamide |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C2=c1ccccc1=C1N=N/C(=N/C(=O)c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C37H37N5O4/c1-6-41(7-2)25-16-20-30-32(22-25)45-33-23-26(42(8-3)9-4)17-21-31(33)34(30)28-12-10-11-13-29(28)36-39-40-37(46-36)38-35(43)24-14-18-27(44-5)19-15-24/h10-23H,6-9H2,1-5H3/b36-29?,38-37- |
| InChIKey | QJVAQMBQXGIOFK-UCTNPCSZSA-N |
| XLogP | 6.49 |
| TPSA | 88.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|