C29H29NO6 — CID 139620196
tert-butyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboperoxoate (PubChem CID 139620196) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is tert-butyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboperoxoate.
| Compound Name | tert-butyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboperoxoate |
|---|---|
| PubChem CID | 139620196 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | tert-butyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboperoxoate |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(C(=O)OOC(C)(C)C)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H29NO6/c1-6-30(7-2)19-13-15-23-25(17-19)33-24-16-18(26(31)35-36-28(3,4)5)12-14-22(24)29(23)21-11-9-8-10-20(21)27(32)34-29/h8-17H,6-7H2,1-5H3 |
| InChIKey | FVTVNDJNAXOTFX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|