About methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate
methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate (PubChem CID 15176948) has the molecular formula C32H28N2O5
and a molecular weight of 520.59 g/mol. Its IUPAC name is methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate |
| PubChem CID | 15176948 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1ccc(Nc3ccccc3C(=O)OC)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C32H28N2O5/c1-4-34(5-2)21-15-16-25-29(19-21)38-28-17-14-20(33-27-13-9-7-11-23(27)30(35)37-3)18-26(28)32(25)24-12-8-6-10-22(24)31(36)39-32/h6-19,33H,4-5H2,1-3H3 |
| InChIKey | FSSIZEPMNCDPED-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate?
The IUPAC name of methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate (CID 15176948) is methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate.
What is the SMILES notation for methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate?
The canonical SMILES for methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate is CCN(CC)c1ccc2c(c1)Oc1ccc(Nc3ccccc3C(=O)OC)cc1C21OC(=O)c2ccccc21.
What is the InChIKey of methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate?
The InChIKey is FSSIZEPMNCDPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H28N2O5/c1-4-34(5-2)21-15-16-25-29(19-21)38-28-17-14-20(33-27-13-9-7-11-23(27)30(35)37-3)18-26(28)32(25)24-12-8-6-10-22(24)31(36)39-32/h6-19,33H,4-5H2,1-3H3.
What are the key properties of methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate?
methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate has a molecular weight of 520.59 g/mol, XLogP of 6.63, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl]amino]benzoate is sourced from PubChem (CID 15176948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).