C28H28N2O6 — CID 23597653
2-[ethyl-[6'-[ethyl(hydroxy)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]amino]ethyl acetate (PubChem CID 23597653) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-[ethyl-[6'-[ethyl(hydroxy)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]amino]ethyl acetate.
| Compound Name | 2-[ethyl-[6'-[ethyl(hydroxy)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]amino]ethyl acetate |
|---|---|
| PubChem CID | 23597653 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-[ethyl-[6'-[ethyl(hydroxy)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]amino]ethyl acetate |
| SMILES | CCN(O)c1ccc2c(c1)Oc1cc(N(CC)CCOC(C)=O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C28H28N2O6/c1-4-29(14-15-34-18(3)31)19-10-12-23-25(16-19)35-26-17-20(30(33)5-2)11-13-24(26)28(23)22-9-7-6-8-21(22)27(32)36-28/h6-13,16-17,33H,4-5,14-15H2,1-3H3 |
| InChIKey | AJPMKQHBJNDZLL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|