C24H23NO6S2 — CID 130357980
2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-sulfinobenzenesulfonic acid (PubChem CID 130357980) has the molecular formula C24H23NO6S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-sulfinobenzenesulfonic acid.
| Compound Name | 2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-sulfinobenzenesulfonic acid |
|---|---|
| PubChem CID | 130357980 |
| Molecular Formula | C24H23NO6S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-[3-(diethylamino)-6-methylidenexanthen-9-yl]-5-sulfinobenzenesulfonic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C=2c1ccc(S(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C24H23NO6S2/c1-4-25(5-2)16-7-10-19-22(13-16)31-21-12-15(3)6-9-18(21)24(19)20-11-8-17(32(26)27)14-23(20)33(28,29)30/h6-14H,3-5H2,1-2H3,(H,26,27)(H,28,29,30) |
| InChIKey | DWILMBJHDKAQEH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|