C11H13F3O2 — CID 81004746
1,4-dimethyl-2-[2-(trifluoromethoxy)ethoxy]benzene (PubChem CID 81004746) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 1,4-dimethyl-2-[2-(trifluoromethoxy)ethoxy]benzene.
| Compound Name | 1,4-dimethyl-2-[2-(trifluoromethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 81004746 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1,4-dimethyl-2-[2-(trifluoromethoxy)ethoxy]benzene |
| SMILES | Cc1ccc(C)c(OCCOC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3O2/c1-8-3-4-9(2)10(7-8)15-5-6-16-11(12,13)14/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | BNVRORMTXAAUFS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|