C17H28O3 — CID 69082461
2-(5,5-dimethoxy-4,4-dimethylpentoxy)-1,4-dimethylbenzene (PubChem CID 69082461) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(5,5-dimethoxy-4,4-dimethylpentoxy)-1,4-dimethylbenzene.
| Compound Name | 2-(5,5-dimethoxy-4,4-dimethylpentoxy)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 69082461 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-(5,5-dimethoxy-4,4-dimethylpentoxy)-1,4-dimethylbenzene |
| SMILES | COC(OC)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C17H28O3/c1-13-8-9-14(2)15(12-13)20-11-7-10-17(3,4)16(18-5)19-6/h8-9,12,16H,7,10-11H2,1-6H3 |
| InChIKey | SOYGKXVOTZORQO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|