C20H23NO — CID 82137406
5-(2,5-dimethylphenoxy)-2-methyl-2-phenylpentanenitrile (PubChem CID 82137406) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2-methyl-2-phenylpentanenitrile.
| Compound Name | 5-(2,5-dimethylphenoxy)-2-methyl-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 82137406 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2-methyl-2-phenylpentanenitrile |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C#N)c2ccccc2)c1 |
| InChI | InChI=1S/C20H23NO/c1-16-10-11-17(2)19(14-16)22-13-7-12-20(3,15-21)18-8-5-4-6-9-18/h4-6,8-11,14H,7,12-13H2,1-3H3 |
| InChIKey | QASZNXCHWQKEQL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|