About 6-azidohexyl 2-(methylamino)benzoate
6-azidohexyl 2-(methylamino)benzoate (PubChem CID 102394313) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-azidohexyl 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | 6-azidohexyl 2-(methylamino)benzoate |
| PubChem CID | 102394313 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-azidohexyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C14H20N4O2/c1-16-13-9-5-4-8-12(13)14(19)20-11-7-3-2-6-10-17-18-15/h4-5,8-9,16H,2-3,6-7,10-11H2,1H3 |
| InChIKey | XBIAVGKJOOHQSP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azidohexyl 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azidohexyl 2-(methylamino)benzoate?
The IUPAC name of 6-azidohexyl 2-(methylamino)benzoate (CID 102394313) is 6-azidohexyl 2-(methylamino)benzoate.
What is the SMILES notation for 6-azidohexyl 2-(methylamino)benzoate?
The canonical SMILES for 6-azidohexyl 2-(methylamino)benzoate is CNc1ccccc1C(=O)OCCCCCCN=[N+]=[N-].
What is the InChIKey of 6-azidohexyl 2-(methylamino)benzoate?
The InChIKey is XBIAVGKJOOHQSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2/c1-16-13-9-5-4-8-12(13)14(19)20-11-7-3-2-6-10-17-18-15/h4-5,8-9,16H,2-3,6-7,10-11H2,1H3.
What are the key properties of 6-azidohexyl 2-(methylamino)benzoate?
6-azidohexyl 2-(methylamino)benzoate has a molecular weight of 276.34 g/mol, XLogP of 3.76, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azidohexyl 2-(methylamino)benzoate is sourced from PubChem (CID 102394313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).