About 2-iodoethyl 2-(methylamino)benzoate
2-iodoethyl 2-(methylamino)benzoate (PubChem CID 25050917) has the molecular formula C10H12INO2
and a molecular weight of 305.12 g/mol. Its IUPAC name is 2-iodoethyl 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | 2-iodoethyl 2-(methylamino)benzoate |
| PubChem CID | 25050917 |
| Molecular Formula | C10H12INO2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 2-iodoethyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCCI |
| InChI | InChI=1S/C10H12INO2/c1-12-9-5-3-2-4-8(9)10(13)14-7-6-11/h2-5,12H,6-7H2,1H3 |
| InChIKey | VKHFCGXUYSARQD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodoethyl 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodoethyl 2-(methylamino)benzoate?
The IUPAC name of 2-iodoethyl 2-(methylamino)benzoate (CID 25050917) is 2-iodoethyl 2-(methylamino)benzoate.
What is the SMILES notation for 2-iodoethyl 2-(methylamino)benzoate?
The canonical SMILES for 2-iodoethyl 2-(methylamino)benzoate is CNc1ccccc1C(=O)OCCI.
What is the InChIKey of 2-iodoethyl 2-(methylamino)benzoate?
The InChIKey is VKHFCGXUYSARQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12INO2/c1-12-9-5-3-2-4-8(9)10(13)14-7-6-11/h2-5,12H,6-7H2,1H3.
What are the key properties of 2-iodoethyl 2-(methylamino)benzoate?
2-iodoethyl 2-(methylamino)benzoate has a molecular weight of 305.12 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodoethyl 2-(methylamino)benzoate is sourced from PubChem (CID 25050917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).