About phosphanyl 2-(methylamino)benzoate
phosphanyl 2-(methylamino)benzoate (PubChem CID 174258583) has the molecular formula C8H10NO2P
and a molecular weight of 183.15 g/mol. Its IUPAC name is phosphanyl 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | phosphanyl 2-(methylamino)benzoate |
| PubChem CID | 174258583 |
| Molecular Formula | C8H10NO2P |
| Molecular Weight | 183.15 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | phosphanyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OP |
| InChI | InChI=1S/C8H10NO2P/c1-9-7-5-3-2-4-6(7)8(10)11-12/h2-5,9H,12H2,1H3 |
| InChIKey | PQSCOCVIMKQIFH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphanyl 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphanyl 2-(methylamino)benzoate?
The IUPAC name of phosphanyl 2-(methylamino)benzoate (CID 174258583) is phosphanyl 2-(methylamino)benzoate.
What is the SMILES notation for phosphanyl 2-(methylamino)benzoate?
The canonical SMILES for phosphanyl 2-(methylamino)benzoate is CNc1ccccc1C(=O)OP.
What is the InChIKey of phosphanyl 2-(methylamino)benzoate?
The InChIKey is PQSCOCVIMKQIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO2P/c1-9-7-5-3-2-4-6(7)8(10)11-12/h2-5,9H,12H2,1H3.
What are the key properties of phosphanyl 2-(methylamino)benzoate?
phosphanyl 2-(methylamino)benzoate has a molecular weight of 183.15 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphanyl 2-(methylamino)benzoate is sourced from PubChem (CID 174258583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).