About 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate
3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate (PubChem CID 103403616) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate |
| PubChem CID | 103403616 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCCCOCCOC |
| InChI | InChI=1S/C14H21NO4/c1-15-13-7-4-3-6-12(13)14(16)19-9-5-8-18-11-10-17-2/h3-4,6-7,15H,5,8-11H2,1-2H3 |
| InChIKey | XTJCOVFTDUZGPE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate?
The IUPAC name of 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate (CID 103403616) is 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate.
What is the SMILES notation for 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate?
The canonical SMILES for 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate is CNc1ccccc1C(=O)OCCCOCCOC.
What is the InChIKey of 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate?
The InChIKey is XTJCOVFTDUZGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-15-13-7-4-3-6-12(13)14(16)19-9-5-8-18-11-10-17-2/h3-4,6-7,15H,5,8-11H2,1-2H3.
What are the key properties of 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate?
3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate has a molecular weight of 267.32 g/mol, XLogP of 1.94, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyethoxy)propyl 2-(methylamino)benzoate is sourced from PubChem (CID 103403616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).