C31H21N5O6 — CID 123501817
2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[2-oxo-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]ethyl]benzoic acid (PubChem CID 123501817) has the molecular formula C31H21N5O6 and a molecular weight of 559.54 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[2-oxo-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]ethyl]benzoic acid.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[2-oxo-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 123501817 |
| Molecular Formula | C31H21N5O6 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)-4-[2-oxo-2-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]ethyl]benzoic acid |
| SMILES | O=C(Cc1ccc(C(=O)O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1)NCc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C31H21N5O6/c37-20-6-9-23-26(13-20)42-27-14-21(38)7-10-24(27)29(23)25-11-18(3-8-22(25)31(40)41)12-28(39)32-15-17-1-4-19(5-2-17)30-35-33-16-34-36-30/h1-11,13-14,16,37H,12,15H2,(H,32,39)(H,40,41) |
| InChIKey | VSWGYAJVPSDTOI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 168.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|