C13H16FN5O5S — CID 172948082
3-[(E)-C-[(3-fluoro-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole (PubChem CID 172948082) has the molecular formula C13H16FN5O5S and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[(E)-C-[(3-fluoro-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole.
| Compound Name | 3-[(E)-C-[(3-fluoro-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 172948082 |
| Molecular Formula | C13H16FN5O5S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-[(E)-C-[(3-fluoro-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole |
| SMILES | Cc1ccc(C/C(=N\O)c2nonc2OCCNS(N)(=O)=O)cc1F |
| InChI | InChI=1S/C13H16FN5O5S/c1-8-2-3-9(6-10(8)14)7-11(17-20)12-13(19-24-18-12)23-5-4-16-25(15,21)22/h2-3,6,16,20H,4-5,7H2,1H3,(H2,15,21,22)/b17-11+ |
| InChIKey | SLOGVZLOURTEKG-GZTJUZNOSA-N |
| XLogP | 0.11 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|