C16H20BrFN4O4S — CID 172923354
5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-(trideuteriomethyl)pentane-1-sulfonamide (PubChem CID 172923354) has the molecular formula C16H20BrFN4O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is 5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-(trideuteriomethyl)pentane-1-sulfonamide.
| Compound Name | 5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-(trideuteriomethyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 172923354 |
| Molecular Formula | C16H20BrFN4O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-(trideuteriomethyl)pentane-1-sulfonamide |
| SMILES | [2H]C([2H])([2H])NS(=O)(=O)CCCCCc1nonc1/C(Cc1ccc(F)c(Br)c1)=N/O |
| InChI | InChI=1S/C16H20BrFN4O4S/c1-19-27(24,25)8-4-2-3-5-14-16(22-26-21-14)15(20-23)10-11-6-7-13(18)12(17)9-11/h6-7,9,19,23H,2-5,8,10H2,1H3/b20-15+/i1D3 |
| InChIKey | BIDXMBFMJDNJPH-DMJNSNTESA-N |
| XLogP | 2.65 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|