C17H20BrFN4O5S — CID 172948192
(NE)-N-[1-[4-[3-(azetidin-1-ylsulfonylmethoxy)propyl]-1,2,5-oxadiazol-3-yl]-2-(3-bromo-4-fluorophenyl)ethylidene]hydroxylamine (PubChem CID 172948192) has the molecular formula C17H20BrFN4O5S and a molecular weight of 491.34 g/mol. Its IUPAC name is (NE)-N-[1-[4-[3-(azetidin-1-ylsulfonylmethoxy)propyl]-1,2,5-oxadiazol-3-yl]-2-(3-bromo-4-fluorophenyl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[4-[3-(azetidin-1-ylsulfonylmethoxy)propyl]-1,2,5-oxadiazol-3-yl]-2-(3-bromo-4-fluorophenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172948192 |
| Molecular Formula | C17H20BrFN4O5S |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | (NE)-N-[1-[4-[3-(azetidin-1-ylsulfonylmethoxy)propyl]-1,2,5-oxadiazol-3-yl]-2-(3-bromo-4-fluorophenyl)ethylidene]hydroxylamine |
| SMILES | O=S(=O)(COCCCc1nonc1/C(Cc1ccc(F)c(Br)c1)=N/O)N1CCC1 |
| InChI | InChI=1S/C17H20BrFN4O5S/c18-13-9-12(4-5-14(13)19)10-16(20-24)17-15(21-28-22-17)3-1-8-27-11-29(25,26)23-6-2-7-23/h4-5,9,24H,1-3,6-8,10-11H2/b20-16+ |
| InChIKey | SBBBNNWWNDRLKP-CAPFRKAQSA-N |
| XLogP | 2.33 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|