C18H21BrFN5O4 — CID 172975587
methyl N-[1-amino-6-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]hexylidene]carbamate (PubChem CID 172975587) has the molecular formula C18H21BrFN5O4 and a molecular weight of 470.30 g/mol. Its IUPAC name is methyl N-[1-amino-6-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]hexylidene]carbamate.
| Compound Name | methyl N-[1-amino-6-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]hexylidene]carbamate |
|---|---|
| PubChem CID | 172975587 |
| Molecular Formula | C18H21BrFN5O4 |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | methyl N-[1-amino-6-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]hexylidene]carbamate |
| SMILES | COC(=O)N=C(N)CCCCCc1nonc1/C(Cc1ccc(F)c(Br)c1)=N/O |
| InChI | InChI=1S/C18H21BrFN5O4/c1-28-18(26)22-16(21)6-4-2-3-5-14-17(25-29-24-14)15(23-27)10-11-7-8-13(20)12(19)9-11/h7-9,27H,2-6,10H2,1H3,(H2,21,22,26)/b23-15+ |
| InChIKey | WNENNVXXFKSSGJ-HZHRSRAPSA-N |
| XLogP | 3.62 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|