C16H21BrN6O2 — CID 172919171
1-[3-[4-[(E)-C-[(3-bromo-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]propyl]-2-methylguanidine (PubChem CID 172919171) has the molecular formula C16H21BrN6O2 and a molecular weight of 409.29 g/mol. Its IUPAC name is 1-[3-[4-[(E)-C-[(3-bromo-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]propyl]-2-methylguanidine.
| Compound Name | 1-[3-[4-[(E)-C-[(3-bromo-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 172919171 |
| Molecular Formula | C16H21BrN6O2 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[3-[4-[(E)-C-[(3-bromo-4-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCCc1nonc1/C(Cc1ccc(C)c(Br)c1)=N/O |
| InChI | InChI=1S/C16H21BrN6O2/c1-10-5-6-11(8-12(10)17)9-14(21-24)15-13(22-25-23-15)4-3-7-20-16(18)19-2/h5-6,8,24H,3-4,7,9H2,1-2H3,(H3,18,19,20)/b21-14+ |
| InChIKey | WRNWWOMQYBOWTA-KGENOOAVSA-N |
| XLogP | 2.03 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|