C17H22BrFN4O4S — CID 172923355
5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-methyl-N-(trideuteriomethyl)pentane-1-sulfonamide (PubChem CID 172923355) has the molecular formula C17H22BrFN4O4S and a molecular weight of 480.37 g/mol. Its IUPAC name is 5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-methyl-N-(trideuteriomethyl)pentane-1-sulfonamide.
| Compound Name | 5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-methyl-N-(trideuteriomethyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 172923355 |
| Molecular Formula | C17H22BrFN4O4S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 5-[4-[(E)-C-[(3-bromo-4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]-1,2,5-oxadiazol-3-yl]-N-methyl-N-(trideuteriomethyl)pentane-1-sulfonamide |
| SMILES | [2H]C([2H])([2H])N(C)S(=O)(=O)CCCCCc1nonc1/C(Cc1ccc(F)c(Br)c1)=N/O |
| InChI | InChI=1S/C17H22BrFN4O4S/c1-23(2)28(25,26)9-5-3-4-6-15-17(22-27-21-15)16(20-24)11-12-7-8-14(19)13(18)10-12/h7-8,10,24H,3-6,9,11H2,1-2H3/b20-16+/i1D3 |
| InChIKey | WWTUJSANSKFPRE-IPCIDWJISA-N |
| XLogP | 3.00 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|