C17H18BrF3N4O4S — CID 172922664
(NE)-N-[2-(3-bromo-4-fluorophenyl)-1-[4-[4-(3,3-difluoroazetidin-1-yl)sulfonylbutyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine (PubChem CID 172922664) has the molecular formula C17H18BrF3N4O4S and a molecular weight of 511.32 g/mol. Its IUPAC name is (NE)-N-[2-(3-bromo-4-fluorophenyl)-1-[4-[4-(3,3-difluoroazetidin-1-yl)sulfonylbutyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(3-bromo-4-fluorophenyl)-1-[4-[4-(3,3-difluoroazetidin-1-yl)sulfonylbutyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172922664 |
| Molecular Formula | C17H18BrF3N4O4S |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | (NE)-N-[2-(3-bromo-4-fluorophenyl)-1-[4-[4-(3,3-difluoroazetidin-1-yl)sulfonylbutyl]-1,2,5-oxadiazol-3-yl]ethylidene]hydroxylamine |
| SMILES | O=S(=O)(CCCCc1nonc1/C(Cc1ccc(F)c(Br)c1)=N/O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C17H18BrF3N4O4S/c18-12-7-11(4-5-13(12)19)8-15(22-26)16-14(23-29-24-16)3-1-2-6-30(27,28)25-9-17(20,21)10-25/h4-5,7,26H,1-3,6,8-10H2/b22-15+ |
| InChIKey | HQNVJVUCCCMHFG-PXLXIMEGSA-N |
| XLogP | 3.00 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|