C19H22FN3O3 — CID 161418971
N-[1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-ylmethyl)-1,2,5-oxadiazol-3-yl]-2-(4-fluoro-3-methylphenyl)ethylidene]hydroxylamine (PubChem CID 161418971) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-ylmethyl)-1,2,5-oxadiazol-3-yl]-2-(4-fluoro-3-methylphenyl)ethylidene]hydroxylamine.
| Compound Name | N-[1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-ylmethyl)-1,2,5-oxadiazol-3-yl]-2-(4-fluoro-3-methylphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 161418971 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-ylmethyl)-1,2,5-oxadiazol-3-yl]-2-(4-fluoro-3-methylphenyl)ethylidene]hydroxylamine |
| SMILES | Cc1cc(CC(=NO)c2nonc2CC2CC3COCC3C2)ccc1F |
| InChI | InChI=1S/C19H22FN3O3/c1-11-4-12(2-3-16(11)20)7-17(21-24)19-18(22-26-23-19)8-13-5-14-9-25-10-15(14)6-13/h2-4,13-15,24H,5-10H2,1H3 |
| InChIKey | NSVCXRWWDHJHKD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|