C14H18FN5O5S — CID 172936222
3-[(E)-C-[(4-fluoro-3-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[1-(sulfamoylamino)propan-2-yloxy]-1,2,5-oxadiazole (PubChem CID 172936222) has the molecular formula C14H18FN5O5S and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-[(E)-C-[(4-fluoro-3-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[1-(sulfamoylamino)propan-2-yloxy]-1,2,5-oxadiazole.
| Compound Name | 3-[(E)-C-[(4-fluoro-3-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[1-(sulfamoylamino)propan-2-yloxy]-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 172936222 |
| Molecular Formula | C14H18FN5O5S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[(E)-C-[(4-fluoro-3-methylphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[1-(sulfamoylamino)propan-2-yloxy]-1,2,5-oxadiazole |
| SMILES | Cc1cc(C/C(=N\O)c2nonc2OC(C)CNS(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C14H18FN5O5S/c1-8-5-10(3-4-11(8)15)6-12(18-21)13-14(20-25-19-13)24-9(2)7-17-26(16,22)23/h3-5,9,17,21H,6-7H2,1-2H3,(H2,16,22,23)/b18-12+ |
| InChIKey | MQMNOUBLGMVSGZ-LDADJPATSA-N |
| XLogP | 0.50 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|