C18H25FN6O5S — CID 157339875
3-[C-[(4-fluoro-3-methoxyphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]amino]-1,2,5-oxadiazole (PubChem CID 157339875) has the molecular formula C18H25FN6O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-[C-[(4-fluoro-3-methoxyphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]amino]-1,2,5-oxadiazole.
| Compound Name | 3-[C-[(4-fluoro-3-methoxyphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]amino]-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 157339875 |
| Molecular Formula | C18H25FN6O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[C-[(4-fluoro-3-methoxyphenyl)methyl]-N-hydroxycarbonimidoyl]-4-[[4-[(sulfamoylamino)methyl]cyclohexyl]amino]-1,2,5-oxadiazole |
| SMILES | COc1cc(CC(=NO)c2nonc2NC2CCC(CNS(N)(=O)=O)CC2)ccc1F |
| InChI | InChI=1S/C18H25FN6O5S/c1-29-16-9-12(4-7-14(16)19)8-15(23-26)17-18(25-30-24-17)22-13-5-2-11(3-6-13)10-21-31(20,27)28/h4,7,9,11,13,21,26H,2-3,5-6,8,10H2,1H3,(H,22,25)(H2,20,27,28) |
| InChIKey | YVFYVXNWEABFAN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|