C12H14ClFN6O4S2 — CID 137360081
N'-(3-chloro-4-fluorophenyl)-4-[(1,1-dihydroxy-1,2,5-thiadiazolidin-3-yl)methylsulfanyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137360081) has the molecular formula C12H14ClFN6O4S2 and a molecular weight of 424.87 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[(1,1-dihydroxy-1,2,5-thiadiazolidin-3-yl)methylsulfanyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[(1,1-dihydroxy-1,2,5-thiadiazolidin-3-yl)methylsulfanyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137360081 |
| Molecular Formula | C12H14ClFN6O4S2 |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[(1,1-dihydroxy-1,2,5-thiadiazolidin-3-yl)methylsulfanyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1nonc1SCC1CNS(O)(O)N1 |
| InChI | InChI=1S/C12H14ClFN6O4S2/c13-8-3-6(1-2-9(8)14)16-11(17-21)10-12(19-24-18-10)25-5-7-4-15-26(22,23)20-7/h1-3,7,15,20-23H,4-5H2,(H,16,17) |
| InChIKey | IVFSLRWVBWGDJJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|