C13H15BrFN7O2S — CID 145385739
4-[[3-(aminosulfanylamino)cyclobutyl]amino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 145385739) has the molecular formula C13H15BrFN7O2S and a molecular weight of 432.28 g/mol. Its IUPAC name is 4-[[3-(aminosulfanylamino)cyclobutyl]amino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[[3-(aminosulfanylamino)cyclobutyl]amino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 145385739 |
| Molecular Formula | C13H15BrFN7O2S |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 4-[[3-(aminosulfanylamino)cyclobutyl]amino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NSNC1CC(Nc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)C1 |
| InChI | InChI=1S/C13H15BrFN7O2S/c14-9-5-6(1-2-10(9)15)17-12(19-23)11-13(21-24-20-11)18-7-3-8(4-7)22-25-16/h1-2,5,7-8,22-23H,3-4,16H2,(H,17,19)(H,18,21) |
| InChIKey | YTHUQOFBZLBILO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|