C15H13BrFN7O3 — CID 176517294
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[2-(oxomethylidene)-1H-imidazol-3-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 176517294) has the molecular formula C15H13BrFN7O3 and a molecular weight of 438.22 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[2-(oxomethylidene)-1H-imidazol-3-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[2-(oxomethylidene)-1H-imidazol-3-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 176517294 |
| Molecular Formula | C15H13BrFN7O3 |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[2-(oxomethylidene)-1H-imidazol-3-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=C=C1NC=CN1CCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C15H13BrFN7O3/c16-10-7-9(1-2-11(10)17)20-15(21-26)13-14(23-27-22-13)19-4-6-24-5-3-18-12(24)8-25/h1-3,5,7,18,26H,4,6H2,(H,19,23)(H,20,21) |
| InChIKey | FLCVNVPUPKRCIF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|