C17H20BrFN8O4 — CID 142514599
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-nitro-1-pyrrolidin-1-ylethenyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142514599) has the molecular formula C17H20BrFN8O4 and a molecular weight of 499.30 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-nitro-1-pyrrolidin-1-ylethenyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-nitro-1-pyrrolidin-1-ylethenyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142514599 |
| Molecular Formula | C17H20BrFN8O4 |
| Molecular Weight | 499.30 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[(2-nitro-1-pyrrolidin-1-ylethenyl)amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=[N+]([O-])C=C(NCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)N1CCCC1 |
| InChI | InChI=1S/C17H20BrFN8O4/c18-12-9-11(3-4-13(12)19)22-17(23-28)15-16(25-31-24-15)21-6-5-20-14(10-27(29)30)26-7-1-2-8-26/h3-4,9-10,20,28H,1-2,5-8H2,(H,21,25)(H,22,23) |
| InChIKey | CVPONWZDEYJYHM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|